C31H30N2O6S — CID 23734702
ethyl 2-[[2-[4-[(2-methoxy-5-methylphenyl)carbamoyl]phenoxy]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 23734702) has the molecular formula C31H30N2O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[(2-methoxy-5-methylphenyl)carbamoyl]phenoxy]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[4-[(2-methoxy-5-methylphenyl)carbamoyl]phenoxy]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23734702 |
| Molecular Formula | C31H30N2O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | ethyl 2-[[2-[4-[(2-methoxy-5-methylphenyl)carbamoyl]phenoxy]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)COc1ccc(C(=O)Nc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C31H30N2O6S/c1-5-38-31(36)28-24(21-9-6-19(2)7-10-21)18-40-30(28)33-27(34)17-39-23-13-11-22(12-14-23)29(35)32-25-16-20(3)8-15-26(25)37-4/h6-16,18H,5,17H2,1-4H3,(H,32,35)(H,33,34) |
| InChIKey | SCXOBTHGFJPYBD-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|