C22H20ClNO5S — CID 987083
ethyl 4-(4-chlorophenyl)-2-[[2-(2-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate (PubChem CID 987083) has the molecular formula C22H20ClNO5S and a molecular weight of 445.92 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[[2-(2-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[[2-(2-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 987083 |
| Molecular Formula | C22H20ClNO5S |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[[2-(2-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)COc1ccccc1OC |
| InChI | InChI=1S/C22H20ClNO5S/c1-3-28-22(26)20-16(14-8-10-15(23)11-9-14)13-30-21(20)24-19(25)12-29-18-7-5-4-6-17(18)27-2/h4-11,13H,3,12H2,1-2H3,(H,24,25) |
| InChIKey | WIFPORRBZCUHDH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|