C20H15ClFNO4S — CID 3456734
methyl 2-[[2-(4-chlorophenoxy)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 3456734) has the molecular formula C20H15ClFNO4S and a molecular weight of 419.86 g/mol. Its IUPAC name is methyl 2-[[2-(4-chlorophenoxy)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-chlorophenoxy)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3456734 |
| Molecular Formula | C20H15ClFNO4S |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | methyl 2-[[2-(4-chlorophenoxy)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClFNO4S/c1-26-20(25)18-16(12-2-6-14(22)7-3-12)11-28-19(18)23-17(24)10-27-15-8-4-13(21)5-9-15/h2-9,11H,10H2,1H3,(H,23,24) |
| InChIKey | OEIIDKDQJVLEJF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|