C24H24ClNO4S — CID 2241912
methyl 4-(4-chlorophenyl)-2-[4-(4-ethylphenoxy)butanoylamino]thiophene-3-carboxylate (PubChem CID 2241912) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[4-(4-ethylphenoxy)butanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[4-(4-ethylphenoxy)butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241912 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[4-(4-ethylphenoxy)butanoylamino]thiophene-3-carboxylate |
| SMILES | CCc1ccc(OCCCC(=O)Nc2scc(-c3ccc(Cl)cc3)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C24H24ClNO4S/c1-3-16-6-12-19(13-7-16)30-14-4-5-21(27)26-23-22(24(28)29-2)20(15-31-23)17-8-10-18(25)11-9-17/h6-13,15H,3-5,14H2,1-2H3,(H,26,27) |
| InChIKey | NZSSTUIVFPKAPI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|