C25H25ClN2O4S2 — CID 19188912
ethyl 2-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19188912) has the molecular formula C25H25ClN2O4S2 and a molecular weight of 517.07 g/mol. Its IUPAC name is ethyl 2-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19188912 |
| Molecular Formula | C25H25ClN2O4S2 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | ethyl 2-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=S)NC(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN2O4S2/c1-3-31-24(30)22-20(17-8-6-16(2)7-9-17)15-34-23(22)28-25(33)27-21(29)5-4-14-32-19-12-10-18(26)11-13-19/h6-13,15H,3-5,14H2,1-2H3,(H2,27,28,29,33) |
| InChIKey | WUAVVXVSPCRFOP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|