C22H20N2O3S2 — CID 1106438
ethyl 2-(benzoylcarbamothioylamino)-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 1106438) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is ethyl 2-(benzoylcarbamothioylamino)-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(benzoylcarbamothioylamino)-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1106438 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | ethyl 2-(benzoylcarbamothioylamino)-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3S2/c1-3-27-21(26)18-17(15-11-9-14(2)10-12-15)13-29-20(18)24-22(28)23-19(25)16-7-5-4-6-8-16/h4-13H,3H2,1-2H3,(H2,23,24,25,28) |
| InChIKey | OEMYMBNRQYNHOT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|