C24H24N2O4S — CID 28693094
ethyl 2-[(2-benzamidoacetyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate (PubChem CID 28693094) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is ethyl 2-[(2-benzamidoacetyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-benzamidoacetyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 28693094 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | ethyl 2-[(2-benzamidoacetyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(CC)cc2)csc1NC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-3-16-10-12-17(13-11-16)19-15-31-23(21(19)24(29)30-4-2)26-20(27)14-25-22(28)18-8-6-5-7-9-18/h5-13,15H,3-4,14H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | KBXCTSMKKNNNRK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|