C23H23NO3S — CID 19229496
methyl 2-[(4-ethylbenzoyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate (PubChem CID 19229496) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 2-[(4-ethylbenzoyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-ethylbenzoyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19229496 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 2-[(4-ethylbenzoyl)amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
| SMILES | CCc1ccc(C(=O)Nc2scc(-c3ccc(CC)cc3)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-4-15-6-10-17(11-7-15)19-14-28-22(20(19)23(26)27-3)24-21(25)18-12-8-16(5-2)9-13-18/h6-14H,4-5H2,1-3H3,(H,24,25) |
| InChIKey | XRHQDDMFVRIKNL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|