C25H25NO3S — CID 19229497
methyl 2-[(4-ethylbenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 19229497) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is methyl 2-[(4-ethylbenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-ethylbenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19229497 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | methyl 2-[(4-ethylbenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | CCc1ccc(C(=O)Nc2scc(-c3ccc4c(c3)CCCC4)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-3-16-8-10-18(11-9-16)23(27)26-24-22(25(28)29-2)21(15-30-24)20-13-12-17-6-4-5-7-19(17)14-20/h8-15H,3-7H2,1-2H3,(H,26,27) |
| InChIKey | ZVSPHPZPBYGGFA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|