C28H31NO4S — CID 19228201
methyl 2-[4-(4-ethylphenoxy)butanoylamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 19228201) has the molecular formula C28H31NO4S and a molecular weight of 477.63 g/mol. Its IUPAC name is methyl 2-[4-(4-ethylphenoxy)butanoylamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(4-ethylphenoxy)butanoylamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19228201 |
| Molecular Formula | C28H31NO4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | methyl 2-[4-(4-ethylphenoxy)butanoylamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | CCc1ccc(OCCCC(=O)Nc2scc(-c3ccc4c(c3)CCCC4)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C28H31NO4S/c1-3-19-10-14-23(15-11-19)33-16-6-9-25(30)29-27-26(28(31)32-2)24(18-34-27)22-13-12-20-7-4-5-8-21(20)17-22/h10-15,17-18H,3-9,16H2,1-2H3,(H,29,30) |
| InChIKey | XKSLATQPAHODAX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|