C27H29NO4S — CID 28693490
ethyl 2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 28693490) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is ethyl 2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 28693490 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | ethyl 2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc3c(c2)CCCC3)csc1NC(=O)Cc1ccc(OCC)cc1 |
| InChI | InChI=1S/C27H29NO4S/c1-3-31-22-13-9-18(10-14-22)15-24(29)28-26-25(27(30)32-4-2)23(17-33-26)21-12-11-19-7-5-6-8-20(19)16-21/h9-14,16-17H,3-8,15H2,1-2H3,(H,28,29) |
| InChIKey | PGSNQBCIQRPIAZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|