C19H20ClNO3S — CID 19226380
methyl 2-(3-chloropropanoylamino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 19226380) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is methyl 2-(3-chloropropanoylamino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-(3-chloropropanoylamino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19226380 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 2-(3-chloropropanoylamino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc3c(c2)CCCC3)csc1NC(=O)CCCl |
| InChI | InChI=1S/C19H20ClNO3S/c1-24-19(23)17-15(11-25-18(17)21-16(22)8-9-20)14-7-6-12-4-2-3-5-13(12)10-14/h6-7,10-11H,2-5,8-9H2,1H3,(H,21,22) |
| InChIKey | ULFUVMZMTOLCHG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|