C24H22ClNO4S — CID 19227757
methyl 2-[[2-(3-chlorophenoxy)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 19227757) has the molecular formula C24H22ClNO4S and a molecular weight of 455.96 g/mol. Its IUPAC name is methyl 2-[[2-(3-chlorophenoxy)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(3-chlorophenoxy)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19227757 |
| Molecular Formula | C24H22ClNO4S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | methyl 2-[[2-(3-chlorophenoxy)acetyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc3c(c2)CCCC3)csc1NC(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22ClNO4S/c1-29-24(28)22-20(17-10-9-15-5-2-3-6-16(15)11-17)14-31-23(22)26-21(27)13-30-19-8-4-7-18(25)12-19/h4,7-12,14H,2-3,5-6,13H2,1H3,(H,26,27) |
| InChIKey | GPQWOGFVYNDNCT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|