C23H23NO5S — CID 19228963
methyl 4-(4-ethylphenyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate (PubChem CID 19228963) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is methyl 4-(4-ethylphenyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-ethylphenyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19228963 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | methyl 4-(4-ethylphenyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCc1ccc(-c2csc(NC(=O)COc3cccc(OC)c3)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-4-15-8-10-16(11-9-15)19-14-30-22(21(19)23(26)28-3)24-20(25)13-29-18-7-5-6-17(12-18)27-2/h5-12,14H,4,13H2,1-3H3,(H,24,25) |
| InChIKey | CQZLGWFRVKSIST-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|