C24H20N2O5S — CID 19199948
methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate (PubChem CID 19199948) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19199948 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
| SMILES | CCc1ccc(-c2csc(NC(=O)CN3C(=O)c4ccccc4C3=O)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C24H20N2O5S/c1-3-14-8-10-15(11-9-14)18-13-32-21(20(18)24(30)31-2)25-19(27)12-26-22(28)16-6-4-5-7-17(16)23(26)29/h4-11,13H,3,12H2,1-2H3,(H,25,27) |
| InChIKey | UKRJVLIRVROSHY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|