C23H19NO3S2 — CID 3581620
methyl 2-(1-benzothiophene-3-carbonylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate (PubChem CID 3581620) has the molecular formula C23H19NO3S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl 2-(1-benzothiophene-3-carbonylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-(1-benzothiophene-3-carbonylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3581620 |
| Molecular Formula | C23H19NO3S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | methyl 2-(1-benzothiophene-3-carbonylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate |
| SMILES | CCc1ccc(-c2csc(NC(=O)c3csc4ccccc34)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C23H19NO3S2/c1-3-14-8-10-15(11-9-14)17-12-29-22(20(17)23(26)27-2)24-21(25)18-13-28-19-7-5-4-6-16(18)19/h4-13H,3H2,1-2H3,(H,24,25) |
| InChIKey | JEXINEYXJFXALY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|