C16H12N2O5S — CID 7166886
methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 7166886) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7166886 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | methyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H12N2O5S/c1-23-16(22)11-6-7-24-13(11)17-12(19)8-18-14(20)9-4-2-3-5-10(9)15(18)21/h2-7H,8H2,1H3,(H,17,19) |
| InChIKey | YQSYLNHXCZGYAG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|