C21H16N4O5S — CID 121065459
methyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate (PubChem CID 121065459) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is methyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate.
| Compound Name | methyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 121065459 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | methyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(NC(=O)CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C21H16N4O5S/c1-30-21(29)24-20-23-16(12-7-3-2-4-8-12)17(31-20)22-15(26)11-25-18(27)13-9-5-6-10-14(13)19(25)28/h2-10H,11H2,1H3,(H,22,26)(H,23,24,29) |
| InChIKey | LZZJJSIVFKUDHK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|