About methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate
methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate (PubChem CID 121065480) has the molecular formula C20H16F3N3O4S
and a molecular weight of 451.43 g/mol. Its IUPAC name is methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 121065480 |
| Molecular Formula | C20H16F3N3O4S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(NC(=O)COc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H16F3N3O4S/c1-29-19(28)26-18-25-16(12-6-3-2-4-7-12)17(31-18)24-15(27)11-30-14-9-5-8-13(10-14)20(21,22)23/h2-10H,11H2,1H3,(H,24,27)(H,25,26,28) |
| InChIKey | YOHDHCLCZPMGIV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate (CID 121065480) is methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate is COC(=O)Nc1nc(-c2ccccc2)c(NC(=O)COc2cccc(C(F)(F)F)c2)s1.
What is the InChIKey of methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate?
The InChIKey is YOHDHCLCZPMGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3N3O4S/c1-29-19(28)26-18-25-16(12-6-3-2-4-7-12)17(31-18)24-15(27)11-30-14-9-5-8-13(10-14)20(21,22)23/h2-10H,11H2,1H3,(H,24,27)(H,25,26,28).
What are the key properties of methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate?
methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate has a molecular weight of 451.43 g/mol, XLogP of 5.02, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-phenyl-5-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 121065480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).