C26H23N3O3S — CID 121065435
methyl N-[5-(3,3-diphenylpropanoylamino)-4-phenyl-1,3-thiazol-2-yl]carbamate (PubChem CID 121065435) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is methyl N-[5-(3,3-diphenylpropanoylamino)-4-phenyl-1,3-thiazol-2-yl]carbamate.
| Compound Name | methyl N-[5-(3,3-diphenylpropanoylamino)-4-phenyl-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 121065435 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | methyl N-[5-(3,3-diphenylpropanoylamino)-4-phenyl-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(NC(=O)CC(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C26H23N3O3S/c1-32-26(31)29-25-28-23(20-15-9-4-10-16-20)24(33-25)27-22(30)17-21(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,21H,17H2,1H3,(H,27,30)(H,28,29,31) |
| InChIKey | IFOLMZQYJZBCJX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |