C21H16N4O4S — CID 121065447
methyl N-[5-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate (PubChem CID 121065447) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is methyl N-[5-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate.
| Compound Name | methyl N-[5-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 121065447 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | methyl N-[5-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(NC(=O)C(=O)c2c[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C21H16N4O4S/c1-29-21(28)25-20-23-16(12-7-3-2-4-8-12)19(30-20)24-18(27)17(26)14-11-22-15-10-6-5-9-13(14)15/h2-11,22H,1H3,(H,24,27)(H,23,25,28) |
| InChIKey | PDEMKADVPAPDCY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|