C19H14N4O2S — CID 22515426
2-(1H-indol-3-yl)-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide (PubChem CID 22515426) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 22515426 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide |
| SMILES | Cc1cccc(-c2nnc(NC(=O)C(=O)c3c[nH]c4ccccc34)s2)c1 |
| InChI | InChI=1S/C19H14N4O2S/c1-11-5-4-6-12(9-11)18-22-23-19(26-18)21-17(25)16(24)14-10-20-15-8-3-2-7-13(14)15/h2-10,20H,1H3,(H,21,23,25) |
| InChIKey | HFOVMJADEHDIIY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|