C21H18N4O3S — CID 22515522
N-[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 22515522) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is N-[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 22515522 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | Cc1ccc(C)c(OCc2nnc(NC(=O)C(=O)c3c[nH]c4ccccc34)s2)c1 |
| InChI | InChI=1S/C21H18N4O3S/c1-12-7-8-13(2)17(9-12)28-11-18-24-25-21(29-18)23-20(27)19(26)15-10-22-16-6-4-3-5-14(15)16/h3-10,22H,11H2,1-2H3,(H,23,25,27) |
| InChIKey | ODWYRGRCIJJOQT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|