C16H18N4O2S — CID 59319901
tert-butyl N-[5-(1H-indol-3-ylmethyl)-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 59319901) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is tert-butyl N-[5-(1H-indol-3-ylmethyl)-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(1H-indol-3-ylmethyl)-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 59319901 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | tert-butyl N-[5-(1H-indol-3-ylmethyl)-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nnc(Cc2c[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C16H18N4O2S/c1-16(2,3)22-15(21)18-14-20-19-13(23-14)8-10-9-17-12-7-5-4-6-11(10)12/h4-7,9,17H,8H2,1-3H3,(H,18,20,21) |
| InChIKey | ULGJMHYWNJGMJW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |