C19H14N6O2S — CID 136697606
N'-[(Z)-1H-indol-3-ylmethylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 136697606) has the molecular formula C19H14N6O2S and a molecular weight of 390.43 g/mol. Its IUPAC name is N'-[(Z)-1H-indol-3-ylmethylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N'-[(Z)-1H-indol-3-ylmethylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 136697606 |
| Molecular Formula | C19H14N6O2S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N'-[(Z)-1H-indol-3-ylmethylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | O=C(N/N=C\c1c[nH]c2ccccc12)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H14N6O2S/c26-16(22-19-25-24-18(28-19)12-6-2-1-3-7-12)17(27)23-21-11-13-10-20-15-9-5-4-8-14(13)15/h1-11,20H,(H,23,27)(H,22,25,26)/b21-11- |
| InChIKey | LMYVXHXELUBLCY-NHDPSOOVSA-N |
| XLogP | 2.78 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|