C24H18BrN5O3S — CID 4640177
N'-[(2-bromo-5-phenylmethoxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 4640177) has the molecular formula C24H18BrN5O3S and a molecular weight of 536.41 g/mol. Its IUPAC name is N'-[(2-bromo-5-phenylmethoxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N'-[(2-bromo-5-phenylmethoxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 4640177 |
| Molecular Formula | C24H18BrN5O3S |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 535.03 |
| IUPAC Name | N'-[(2-bromo-5-phenylmethoxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | O=C(NN=Cc1cc(OCc2ccccc2)ccc1Br)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C24H18BrN5O3S/c25-20-12-11-19(33-15-16-7-3-1-4-8-16)13-18(20)14-26-28-22(32)21(31)27-24-30-29-23(34-24)17-9-5-2-6-10-17/h1-14H,15H2,(H,28,32)(H,27,30,31) |
| InChIKey | SPCQTQUEVJZJRC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|