C25H21BrN2O4 — CID 6874050
N-[(E)-(2-bromo-5-prop-2-ynoxyphenyl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide (PubChem CID 6874050) has the molecular formula C25H21BrN2O4 and a molecular weight of 493.36 g/mol. Its IUPAC name is N-[(E)-(2-bromo-5-prop-2-ynoxyphenyl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide.
| Compound Name | N-[(E)-(2-bromo-5-prop-2-ynoxyphenyl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 6874050 |
| Molecular Formula | C25H21BrN2O4 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N-[(E)-(2-bromo-5-prop-2-ynoxyphenyl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide |
| SMILES | C#CCOc1ccc(Br)c(/C=N/NC(=O)COc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H21BrN2O4/c1-2-14-30-23-12-13-24(26)20(15-23)16-27-28-25(29)18-32-22-10-8-21(9-11-22)31-17-19-6-4-3-5-7-19/h1,3-13,15-16H,14,17-18H2,(H,28,29)/b27-16+ |
| InChIKey | VZUPNXXYCNLTNL-JVWAILMASA-N |
| XLogP | 4.57 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|