C25H19N5O4S — CID 3841025
[4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 3841025) has the molecular formula C25H19N5O4S and a molecular weight of 485.53 g/mol. Its IUPAC name is [4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 3841025 |
| Molecular Formula | C25H19N5O4S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3nnc(-c4ccccc4)s3)cc2)c1 |
| InChI | InChI=1S/C25H19N5O4S/c1-16-6-5-9-19(14-16)24(33)34-20-12-10-17(11-13-20)15-26-28-22(32)21(31)27-25-30-29-23(35-25)18-7-3-2-4-8-18/h2-15H,1H3,(H,28,32)(H,27,30,31) |
| InChIKey | QEWRAMMKTSENME-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|