C25H19N5O5S — CID 3857294
[3-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 3857294) has the molecular formula C25H19N5O5S and a molecular weight of 501.52 g/mol. Its IUPAC name is [3-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [3-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3857294 |
| Molecular Formula | C25H19N5O5S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | [3-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(C=NNC(=O)C(=O)Nc3nnc(-c4ccccc4)s3)c2)cc1 |
| InChI | InChI=1S/C25H19N5O5S/c1-34-19-12-10-18(11-13-19)24(33)35-20-9-5-6-16(14-20)15-26-28-22(32)21(31)27-25-30-29-23(36-25)17-7-3-2-4-8-17/h2-15H,1H3,(H,28,32)(H,27,30,31) |
| InChIKey | PULGYHNIEMIYHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|