C17H12ClN5O2S — CID 3709112
N'-[(4-chlorophenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 3709112) has the molecular formula C17H12ClN5O2S and a molecular weight of 385.84 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N'-[(4-chlorophenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 3709112 |
| Molecular Formula | C17H12ClN5O2S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N'-[(4-chlorophenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H12ClN5O2S/c18-13-8-6-11(7-9-13)10-19-21-15(25)14(24)20-17-23-22-16(26-17)12-4-2-1-3-5-12/h1-10H,(H,21,25)(H,20,23,24) |
| InChIKey | QLYYXMGXVONAKB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|