C28H17Cl2N5O4S — CID 6185836
[1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 6185836) has the molecular formula C28H17Cl2N5O4S and a molecular weight of 590.45 g/mol. Its IUPAC name is [1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 6185836 |
| Molecular Formula | C28H17Cl2N5O4S |
| Molecular Weight | 590.45 g/mol |
| Exact Mass | 589.04 |
| IUPAC Name | [1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | O=C(N/N=C\c1c(OC(=O)c2ccc(Cl)cc2Cl)ccc2ccccc12)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C28H17Cl2N5O4S/c29-18-11-12-20(22(30)14-18)27(38)39-23-13-10-16-6-4-5-9-19(16)21(23)15-31-33-25(37)24(36)32-28-35-34-26(40-28)17-7-2-1-3-8-17/h1-15H,(H,33,37)(H,32,35,36)/b31-15- |
| InChIKey | ZUYZFJXLHLRDKY-BVMLUPFRSA-N |
| XLogP | 5.97 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|