C29H20Cl2N4O4S — CID 3727661
[1-[[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 3727661) has the molecular formula C29H20Cl2N4O4S and a molecular weight of 591.48 g/mol. Its IUPAC name is [1-[[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3727661 |
| Molecular Formula | C29H20Cl2N4O4S |
| Molecular Weight | 591.48 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | [1-[[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | N#Cc1c(NC(=O)C(=O)NN=Cc2c(OC(=O)c3ccc(Cl)cc3Cl)ccc3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C29H20Cl2N4O4S/c30-17-10-11-20(23(31)13-17)29(38)39-24-12-9-16-5-1-2-6-18(16)22(24)15-33-35-27(37)26(36)34-28-21(14-32)19-7-3-4-8-25(19)40-28/h1-2,5-6,9-13,15H,3-4,7-8H2,(H,34,36)(H,35,37) |
| InChIKey | KJBXNUBUYQRNGG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|