C17H13N5O3S — CID 135678785
N'-[(E)-(2-hydroxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 135678785) has the molecular formula C17H13N5O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is N'-[(E)-(2-hydroxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N'-[(E)-(2-hydroxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 135678785 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N'-[(E)-(2-hydroxyphenyl)methylideneamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H13N5O3S/c23-13-9-5-4-8-12(13)10-18-20-15(25)14(24)19-17-22-21-16(26-17)11-6-2-1-3-7-11/h1-10,23H,(H,20,25)(H,19,22,24)/b18-10+ |
| InChIKey | XFADDDZRKXGUKY-VCHYOVAHSA-N |
| XLogP | 2.00 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|