C25H18ClN5O5S — CID 4232293
[2-methoxy-4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 4232293) has the molecular formula C25H18ClN5O5S and a molecular weight of 535.97 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4232293 |
| Molecular Formula | C25H18ClN5O5S |
| Molecular Weight | 535.97 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | [2-methoxy-4-[[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2nnc(-c3ccccc3)s2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClN5O5S/c1-35-20-13-15(7-12-19(20)36-24(34)17-8-10-18(26)11-9-17)14-27-29-22(33)21(32)28-25-31-30-23(37-25)16-5-3-2-4-6-16/h2-14H,1H3,(H,29,33)(H,28,31,32) |
| InChIKey | RMOPZTSKFOBCOE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.97 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|