C27H22ClN5O5S — CID 6868530
[2-methoxy-4-[(E)-[[2-[5-[(4-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6868530) has the molecular formula C27H22ClN5O5S and a molecular weight of 564.02 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[[2-[5-[(4-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-[[2-[5-[(4-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6868530 |
| Molecular Formula | C27H22ClN5O5S |
| Molecular Weight | 564.02 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | [2-methoxy-4-[(E)-[[2-[5-[(4-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=N/NC(=O)Cc2nnc(NC(=O)c3ccc(C)cc3)s2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClN5O5S/c1-16-3-6-18(7-4-16)25(35)30-27-33-32-24(39-27)14-23(34)31-29-15-17-5-12-21(22(13-17)37-2)38-26(36)19-8-10-20(28)11-9-19/h3-13,15H,14H2,1-2H3,(H,31,34)(H,30,33,35)/b29-15+ |
| InChIKey | ZDPSOEPOXVAJHV-WKULSOCRSA-N |
| XLogP | 4.67 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.02 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|