C19H16N6O6S — CID 135495607
N-[5-[2-[(2E)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide (PubChem CID 135495607) has the molecular formula C19H16N6O6S and a molecular weight of 456.44 g/mol. Its IUPAC name is N-[5-[2-[(2E)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide.
| Compound Name | N-[5-[2-[(2E)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 135495607 |
| Molecular Formula | C19H16N6O6S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-[5-[2-[(2E)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2nnc(NC(=O)c3ccc([N+](=O)[O-])cc3)s2)ccc1O |
| InChI | InChI=1S/C19H16N6O6S/c1-31-15-8-11(2-7-14(15)26)10-20-22-16(27)9-17-23-24-19(32-17)21-18(28)12-3-5-13(6-4-12)25(29)30/h2-8,10,26H,9H2,1H3,(H,22,27)(H,21,24,28)/b20-10+ |
| InChIKey | CKFQDBFVLWMKCN-KEBDBYFISA-N |
| XLogP | 2.11 |
| TPSA | 168.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|