C19H16IN5O4S — CID 137060127
N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-iodobenzamide (PubChem CID 137060127) has the molecular formula C19H16IN5O4S and a molecular weight of 537.34 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-iodobenzamide.
| Compound Name | N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 137060127 |
| Molecular Formula | C19H16IN5O4S |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 537.00 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-iodobenzamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2nnc(NC(=O)c3ccccc3I)s2)ccc1O |
| InChI | InChI=1S/C19H16IN5O4S/c1-29-15-8-11(6-7-14(15)26)10-21-23-16(27)9-17-24-25-19(30-17)22-18(28)12-4-2-3-5-13(12)20/h2-8,10,26H,9H2,1H3,(H,23,27)(H,22,25,28)/b21-10- |
| InChIKey | LNSVRQLJVDJAAV-FBHDLOMBSA-N |
| XLogP | 2.80 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|