C19H17N5O5S — CID 136861921
N-[5-[2-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide (PubChem CID 136861921) has the molecular formula C19H17N5O5S and a molecular weight of 427.44 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[2-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 136861921 |
| Molecular Formula | C19H17N5O5S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(CC(=O)N/N=C\c3ccc(O)c(O)c3)s2)cc1 |
| InChI | InChI=1S/C19H17N5O5S/c1-29-13-5-3-12(4-6-13)18(28)21-19-24-23-17(30-19)9-16(27)22-20-10-11-2-7-14(25)15(26)8-11/h2-8,10,25-26H,9H2,1H3,(H,22,27)(H,21,24,28)/b20-10- |
| InChIKey | QUOISSHGVTWXBG-JMIUGGIZSA-N |
| XLogP | 1.90 |
| TPSA | 146.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|