C17H15N5O3S2 — CID 6883663
4-methoxy-N-[5-[2-oxo-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 6883663) has the molecular formula C17H15N5O3S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-methoxy-N-[5-[2-oxo-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[5-[2-oxo-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 6883663 |
| Molecular Formula | C17H15N5O3S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 4-methoxy-N-[5-[2-oxo-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(CC(=O)N/N=C/c3cccs3)s2)cc1 |
| InChI | InChI=1S/C17H15N5O3S2/c1-25-12-6-4-11(5-7-12)16(24)19-17-22-21-15(27-17)9-14(23)20-18-10-13-3-2-8-26-13/h2-8,10H,9H2,1H3,(H,20,23)(H,19,22,24)/b18-10+ |
| InChIKey | XXAKMLGMFPUIFU-VCHYOVAHSA-N |
| XLogP | 2.55 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|