C27H21N5O3S — CID 3104799
N-[5-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide (PubChem CID 3104799) has the molecular formula C27H21N5O3S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-[5-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3104799 |
| Molecular Formula | C27H21N5O3S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-[5-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(CC(=O)NN=Cc3c4ccccc4cc4ccccc34)s2)cc1 |
| InChI | InChI=1S/C27H21N5O3S/c1-35-20-12-10-17(11-13-20)26(34)29-27-32-31-25(36-27)15-24(33)30-28-16-23-21-8-4-2-6-18(21)14-19-7-3-5-9-22(19)23/h2-14,16H,15H2,1H3,(H,30,33)(H,29,32,34) |
| InChIKey | NKXGIZIPUFXGGI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|