C33H35N5O5S — CID 4005416
N-[5-[2-[2-[[2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide (PubChem CID 4005416) has the molecular formula C33H35N5O5S and a molecular weight of 613.74 g/mol. Its IUPAC name is N-[5-[2-[2-[[2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[2-[2-[[2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4005416 |
| Molecular Formula | C33H35N5O5S |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | N-[5-[2-[2-[[2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(CC(=O)NN=Cc3ccccc3OCCOc3ccc(C4CCCCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C33H35N5O5S/c1-41-27-15-13-25(14-16-27)32(40)35-33-38-37-31(44-33)21-30(39)36-34-22-26-9-5-6-10-29(26)43-20-19-42-28-17-11-24(12-18-28)23-7-3-2-4-8-23/h5-6,9-18,22-23H,2-4,7-8,19-21H2,1H3,(H,36,39)(H,35,38,40) |
| InChIKey | PHYXWIAHJDWLFB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|