C17H15N7O6S — CID 137060023
N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 137060023) has the molecular formula C17H15N7O6S and a molecular weight of 445.42 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 137060023 |
| Molecular Formula | C17H15N7O6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2nnc(NC(=O)c3cc(=O)[nH]c(=O)[nH]3)s2)ccc1O |
| InChI | InChI=1S/C17H15N7O6S/c1-30-11-4-8(2-3-10(11)25)7-18-22-13(27)6-14-23-24-17(31-14)21-15(28)9-5-12(26)20-16(29)19-9/h2-5,7,25H,6H2,1H3,(H,22,27)(H,21,24,28)(H2,19,20,26,29)/b18-7- |
| InChIKey | DYJNUUKESZYYQB-WSVATBPTSA-N |
| XLogP | -0.43 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|