C16H12N8O6S — CID 4031958
N-[5-[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 4031958) has the molecular formula C16H12N8O6S and a molecular weight of 444.39 g/mol. Its IUPAC name is N-[5-[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[5-[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 4031958 |
| Molecular Formula | C16H12N8O6S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[5-[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(Cc1nnc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)s1)NN=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N8O6S/c25-11-5-10(18-15(28)19-11)14(27)20-16-23-22-13(31-16)6-12(26)21-17-7-8-2-1-3-9(4-8)24(29)30/h1-5,7H,6H2,(H,21,26)(H,20,23,27)(H2,18,19,25,28) |
| InChIKey | NYNOUOOSJWPDRP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 205.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|