C27H24N6O6S — CID 44660104
2-methyl-N-[5-[2-[(2E)-2-[[4-[2-(4-nitrophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44660104) has the molecular formula C27H24N6O6S and a molecular weight of 560.59 g/mol. Its IUPAC name is 2-methyl-N-[5-[2-[(2E)-2-[[4-[2-(4-nitrophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-methyl-N-[5-[2-[(2E)-2-[[4-[2-(4-nitrophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44660104 |
| Molecular Formula | C27H24N6O6S |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 2-methyl-N-[5-[2-[(2E)-2-[[4-[2-(4-nitrophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nnc(CC(=O)N/N=C/c2ccc(OCCOc3ccc([N+](=O)[O-])cc3)cc2)s1 |
| InChI | InChI=1S/C27H24N6O6S/c1-18-4-2-3-5-23(18)26(35)29-27-32-31-25(40-27)16-24(34)30-28-17-19-6-10-21(11-7-19)38-14-15-39-22-12-8-20(9-13-22)33(36)37/h2-13,17H,14-16H2,1H3,(H,30,34)(H,29,32,35)/b28-17+ |
| InChIKey | XVNVAGPJYBCOBT-OGLMXYFKSA-N |
| XLogP | 4.16 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|