C24H20BrN5O5S — CID 3717615
N-[5-[2-[2-[[4-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 3717615) has the molecular formula C24H20BrN5O5S and a molecular weight of 570.43 g/mol. Its IUPAC name is N-[5-[2-[2-[[4-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-[2-[[4-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3717615 |
| Molecular Formula | C24H20BrN5O5S |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | N-[5-[2-[2-[[4-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1nnc(NC(=O)c2ccco2)s1)NN=Cc1ccc(OCCOc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H20BrN5O5S/c25-17-5-9-19(10-6-17)34-13-12-33-18-7-3-16(4-8-18)15-26-28-21(31)14-22-29-30-24(36-22)27-23(32)20-2-1-11-35-20/h1-11,15H,12-14H2,(H,28,31)(H,27,30,32) |
| InChIKey | TUHZUMNIROQFAD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|