C21H14F3N5O4S — CID 3803753
N-[5-[2-oxo-2-[2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 3803753) has the molecular formula C21H14F3N5O4S and a molecular weight of 489.44 g/mol. Its IUPAC name is N-[5-[2-oxo-2-[2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-oxo-2-[2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3803753 |
| Molecular Formula | C21H14F3N5O4S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-[5-[2-oxo-2-[2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1nnc(NC(=O)c2ccco2)s1)NN=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C21H14F3N5O4S/c22-21(23,24)13-4-1-3-12(9-13)15-7-6-14(33-15)11-25-27-17(30)10-18-28-29-20(34-18)26-19(31)16-5-2-8-32-16/h1-9,11H,10H2,(H,27,30)(H,26,29,31) |
| InChIKey | PKTXYLAPXGHLCV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|