C20H14F3N3O4 — CID 124551697
2-(2-nitrophenyl)-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide (PubChem CID 124551697) has the molecular formula C20H14F3N3O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124551697 |
| Molecular Formula | C20H14F3N3O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])N/N=C/c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H14F3N3O4/c21-20(22,23)15-6-3-5-14(10-15)18-9-8-16(30-18)12-24-25-19(27)11-13-4-1-2-7-17(13)26(28)29/h1-10,12H,11H2,(H,25,27)/b24-12+ |
| InChIKey | HRHHLUBJHRXJID-WYMPLXKRSA-N |
| XLogP | 4.57 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|