C20H15N3O7 — CID 3939353
3-[5-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 3939353) has the molecular formula C20H15N3O7 and a molecular weight of 409.35 g/mol. Its IUPAC name is 3-[5-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3939353 |
| Molecular Formula | C20H15N3O7 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-[5-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NN=Cc1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C20H15N3O7/c24-19(12-29-18-7-2-1-6-16(18)23(27)28)22-21-11-15-8-9-17(30-15)13-4-3-5-14(10-13)20(25)26/h1-11H,12H2,(H,22,24)(H,25,26) |
| InChIKey | KFVHAKJPTHRPEC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_furan_E(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|