C20H12Br3F3N2O3 — CID 4030641
2-(2,4,6-tribromophenoxy)-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide (PubChem CID 4030641) has the molecular formula C20H12Br3F3N2O3 and a molecular weight of 625.03 g/mol. Its IUPAC name is 2-(2,4,6-tribromophenoxy)-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,4,6-tribromophenoxy)-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4030641 |
| Molecular Formula | C20H12Br3F3N2O3 |
| Molecular Weight | 625.03 g/mol |
| Exact Mass | 621.84 |
| IUPAC Name | 2-(2,4,6-tribromophenoxy)-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)NN=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H12Br3F3N2O3/c21-13-7-15(22)19(16(23)8-13)30-10-18(29)28-27-9-14-4-5-17(31-14)11-2-1-3-12(6-11)20(24,25)26/h1-9H,10H2,(H,28,29) |
| InChIKey | VAXWVDISWDHKMI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.03 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|