C19H13Br2FN2O3 — CID 126021004
2-(2,4-dibromophenoxy)-N-[(E)-[5-(3-fluorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126021004) has the molecular formula C19H13Br2FN2O3 and a molecular weight of 496.13 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(E)-[5-(3-fluorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(E)-[5-(3-fluorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126021004 |
| Molecular Formula | C19H13Br2FN2O3 |
| Molecular Weight | 496.13 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(E)-[5-(3-fluorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)N/N=C/c1ccc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C19H13Br2FN2O3/c20-13-4-6-18(16(21)9-13)26-11-19(25)24-23-10-15-5-7-17(27-15)12-2-1-3-14(22)8-12/h1-10H,11H2,(H,24,25)/b23-10+ |
| InChIKey | PNXKTKADAYREND-AUEPDCJTSA-N |
| XLogP | 5.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.13 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|